Fmoc-Phe-OH-15N structure
|
Common Name | Fmoc-Phe-OH-15N | ||
|---|---|---|---|---|
| CAS Number | 125700-32-5 | Molecular Weight | 388.42 | |
| Density | 1.328g/cm3 | Boiling Point | 322ºC at 760 mmHg | |
| Molecular Formula | C24H2115NO4 | Melting Point | 180-187ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-Phe-OH-15NFmoc-Phe-OH-15N is a 15N-labeled Propoxur. |
| Name | fmoc-[15n]phe-oh |
|---|
| Description | Fmoc-Phe-OH-15N is a 15N-labeled Propoxur. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[75]. |
| References |
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 322ºC at 760 mmHg |
| Melting Point | 180-187ºC(lit.) |
| Molecular Formula | C24H2115NO4 |
| Molecular Weight | 388.42 |
| Exact Mass | 388.14400 |
| PSA | 75.63000 |
| LogP | 4.61190 |
| InChIKey | SJVFAHZPLIXNDH-LJSUXKQBSA-N |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | -15°C |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |