5-[4-(1,1-dioxothiomorpholin-4-ylmethyl)-phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine structure
|
Common Name | 5-[4-(1,1-dioxothiomorpholin-4-ylmethyl)-phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine | ||
|---|---|---|---|---|
| CAS Number | 1257705-09-1 | Molecular Weight | N/A | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | N/A | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-[4-(1,1-dioxothiomorpholin-4-ylmethyl)-phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-ylamineGS-829845 is a major, active metabolite of Filgotinib (HY-18300). GS-829845 is a JAK1 preferential inhibitor but is approximately 10-fold less potent than the parent and with a longer half-life[1][2]. |
| Name | [1,2,4]Triazolo[1,5-a]pyridin-2-amine, 5-[4-[(1,1-dioxido-4-thiomorpholinyl)methyl]phenyl]- |
|---|
| Description | GS-829845 is a major, active metabolite of Filgotinib (HY-18300). GS-829845 is a JAK1 preferential inhibitor but is approximately 10-fold less potent than the parent and with a longer half-life[1][2]. |
|---|---|
| Related Catalog | |
| Target |
JAK1 |
| References |
| InChIKey | BYWJAVQGRJEEHH-UHFFFAOYSA-N |
|---|---|
| SMILES | Nc1nc2cccc(-c3ccc(CN4CCS(=O)(=O)CC4)cc3)n2n1 |