Sarpogrelate structure
|
Common Name | Sarpogrelate | ||
|---|---|---|---|---|
| CAS Number | 125926-17-2 | Molecular Weight | 429.506 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 585.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H31NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.1±30.1 °C | |
Use of SarpogrelateSarpogrelate (MCI-9042) is a new, specific orally active 5-HT2 receptor antagonist, Sarpogrelate (MCI-9042) increases platelet aggregation and has hemostasis effect, and can be used for the research of Buerger’s disease[1]. |
| Name | 4-[1-(dimethylamino)-3-[2-[2-(3-methoxyphenyl)ethyl]phenoxy]propan-2-yl]oxy-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Sarpogrelate (MCI-9042) is a new, specific orally active 5-HT2 receptor antagonist, Sarpogrelate (MCI-9042) increases platelet aggregation and has hemostasis effect, and can be used for the research of Buerger’s disease[1]. |
|---|---|
| Related Catalog | |
| Target |
5-HT2 Receptor |
| In Vitro | Sarpogrelate (MCI-9042) induces a significant decrease in plasma serotonin (5-HT) concentration and after 2 weeks increases significantly the concentration of whole blood 5-HT. Sarpogrelate (MCI-9042) increases significantly plasma tryptophan concentration after 2 and 4 weeks, and no changes in plasma 5-HIAA concentration. Sarpogrelate (MCI-9042) also has a tendency to increase the concentration of whole blood tryptophan concentration, did not show significant changes in platelet aggregation induced by ADP and collagen. Sarpogrelate (MCI-9042) increases significantly platelet aggregation induced by serotonin after 2 weeks[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 585.9±50.0 °C at 760 mmHg |
| Molecular Formula | C24H31NO6 |
| Molecular Weight | 429.506 |
| Flash Point | 308.1±30.1 °C |
| Exact Mass | 429.215149 |
| PSA | 85.30000 |
| LogP | 3.68 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | FFYNAVGJSYHHFO-UHFFFAOYSA-N |
| SMILES | COc1cccc(CCc2ccccc2OCC(CN(C)C)OC(=O)CCC(=O)O)c1 |
| UNII-19P708E787 |
| Sarpogrelate Hydrochloride |
| Butanedioic acid, mono[2-(dimethylamino)-1-[[2-[2-(3-methoxyphenyl)ethyl]phenoxy]methyl]ethyl] ester |
| 4-{[1-(Dimethylamino)-3-{2-[2-(3-methoxyphenyl)ethyl]phenoxy}-2-propanyl]oxy}-4-oxobutanoic acid |
| Sarpogrelate |