(S)-Methanesulphonic acid 2-Boc-aminopropyl ester structure
|
Common Name | (S)-Methanesulphonic acid 2-Boc-aminopropyl ester | ||
|---|---|---|---|---|
| CAS Number | 126301-16-4 | Molecular Weight | 253.31600 | |
| Density | 1.166g/cm3 | Boiling Point | 397.918ºC at 760 mmHg | |
| Molecular Formula | C9H19NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.454ºC | |
| Name | [(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 397.918ºC at 760 mmHg |
| Molecular Formula | C9H19NO5S |
| Molecular Weight | 253.31600 |
| Flash Point | 194.454ºC |
| Exact Mass | 253.09800 |
| PSA | 90.08000 |
| LogP | 2.34750 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | NLKBUJQLMRHSKP-ZETCQYMHSA-N |
| SMILES | CC(COS(C)(=O)=O)NC(=O)OC(C)(C)C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924199090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD13188533 |