2,2,3,3,3-pentafluoropropyl trifluoromethanesulfonate structure
|
Common Name | 2,2,3,3,3-pentafluoropropyl trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 6401-00-9 | Molecular Weight | 282.10900 | |
| Density | 1.702g/cm3 | Boiling Point | 102-105ºC | |
| Molecular Formula | C4H2F8O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 27.4ºC | |
| Name | 2,2,3,3,3-pentafluoropropyl trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.702g/cm3 |
|---|---|
| Boiling Point | 102-105ºC |
| Molecular Formula | C4H2F8O3S |
| Molecular Weight | 282.10900 |
| Flash Point | 27.4ºC |
| Exact Mass | 281.96000 |
| PSA | 51.75000 |
| LogP | 3.13100 |
| Index of Refraction | 1.3012 |
| InChIKey | QHZUUSNAUOEJBB-UHFFFAOYSA-N |
| SMILES | O=S(=O)(OCC(F)(F)C(F)(F)F)C(F)(F)F |
| Hazard Codes | C: Corrosive;T: Toxic; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2905590090 |
|
~99%
2,2,3,3,3-penta... CAS#:6401-00-9 |
| Literature: J. URIACH and CIA. S.A. Patent: WO2004/9528 A1, 2004 ; Location in patent: Page 29 ; |
|
~%
2,2,3,3,3-penta... CAS#:6401-00-9 |
| Literature: Hansen,R.L. Journal of Organic Chemistry, 1965 , vol. 30, p. 4322 - 4324 |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3,3,3,2,2,-pentafluoropropyl trifluoromethanesulfonate |
| 2,2,3,3,3-PENTAFLUOROPROPYL METHACRYLATE |
| trifluoro-methanesulfonic acid 2,2,3,3,3-pentafluoro-propyl ester |
| PC1327 |
| 2,2,3,3,3-pentafluoropropyl trifluoromethansulfonate |
| trifluoro-methanesulphonic acid 2,2,3,3,3-pentafluoropropyl ester |
| 2,2,3,3,3-Pentafluoropropyltriflate |