1-(2-(CHLOROMETHYL)-5-PHENYLFURAN-3-YL)ETHANONE structure
|
Common Name | 1-(2-(CHLOROMETHYL)-5-PHENYLFURAN-3-YL)ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 126501-70-0 | Molecular Weight | 225.16500 | |
| Density | 1.43g/cm3 | Boiling Point | 386.6ºC at 760mmHg | |
| Molecular Formula | C8H10F3NO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 187.6ºC | |
| Name | 1-(2,2,2-trifluoroacetyl)piperidine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 386.6ºC at 760mmHg |
| Molecular Formula | C8H10F3NO3 |
| Molecular Weight | 225.16500 |
| Flash Point | 187.6ºC |
| Exact Mass | 225.06100 |
| PSA | 57.61000 |
| LogP | 0.80980 |
| Vapour Pressure | 4.73E-07mmHg at 25°C |
| Index of Refraction | 1.451 |
| InChIKey | USCGUOIGFONADD-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CCN(C(=O)C(F)(F)F)CC1 |
| HS Code | 2933399090 |
|---|
|
~70%
1-(2-(CHLOROMET... CAS#:126501-70-0 |
| Literature: ABBOTT LABORATORIES; ABBOTT LABORATORIES TRADING (SHANGHAI) COMPANY, LTD.; WANG, Xueqing; MEYER, Michael; YAO, Betty; GUO, Tao; WEI, Guo Ping,Robert; WANG, Lijuan, Jane Patent: WO2013/10453 A1, 2013 ; Location in patent: Page/Page column 109 ; |
|
~73%
1-(2-(CHLOROMET... CAS#:126501-70-0 |
| Literature: Hibert; Hoffmann; Miller; Carr Journal of Medicinal Chemistry, 1990 , vol. 33, # 6 p. 1594 - 1600 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(trifluoroacetyl)piperidine-4-carboxylic acid |
| 4-Piperidinecarboxylicacid,1-(2,2,2-trifluoroacetyl) |
| 1-(2,2,2-trifluoroacetyl)-4-piperidinecarboxylic acid |
| N-trifluoroacetyl isonipecotic acid |