5'-O-DMT-2'-O-TBDMS-rI structure
|
Common Name | 5'-O-DMT-2'-O-TBDMS-rI | ||
|---|---|---|---|---|
| CAS Number | 127212-34-4 | Molecular Weight | 684.85 | |
| Density | 1.24±0.1 g/cm3 | Boiling Point | 831.1±65.0 °C | |
| Molecular Formula | C37H44N4O7Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5'-O-DMT-2'-O-TBDMS-rI5'-O-DMT-2'-O-TBDMS-rI is a modified nucleoside. 5'-O-DMT-2'-O-TBDMS-rI can be used in the synthesis of deoxyribonucleic acid or nucleic acid. |
| Name | 5'-O-DMT-2'-O-TBDMS-rI |
|---|
| Description | 5'-O-DMT-2'-O-TBDMS-rI is a modified nucleoside. 5'-O-DMT-2'-O-TBDMS-rI can be used in the synthesis of deoxyribonucleic acid or nucleic acid. |
|---|---|
| Related Catalog |
| Density | 1.24±0.1 g/cm3 |
|---|---|
| Boiling Point | 831.1±65.0 °C |
| Molecular Formula | C37H44N4O7Si |
| Molecular Weight | 684.85 |
| InChIKey | OPTOBSYBLQDPQN-QSYCCZFCSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3cnc4c(=O)[nH]cnc43)C(O[Si](C)(C)C(C)(C)C)C2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |