AKR1C3 Inhibitor 5f structure
|
Common Name | AKR1C3 Inhibitor 5f | ||
|---|---|---|---|---|
| CAS Number | 1275482-57-9 | Molecular Weight | 243.258 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 420.1±30.0 °C at 760 mmHg | |
| Molecular Formula | C14H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.8±24.6 °C | |
Use of AKR1C3 Inhibitor 5fA highly potent and selective inhibitor of the type 5 17-β-hydroxysteroid dehydrogenase AKR1C3. |
| Name | 4-[(2-Methoxyphenyl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 420.1±30.0 °C at 760 mmHg |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.258 |
| Flash Point | 207.8±24.6 °C |
| Exact Mass | 243.089539 |
| LogP | 2.98 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | QVPCGPXETWLTDU-UHFFFAOYSA-N |
| SMILES | COc1ccccc1Nc1ccc(C(=O)O)cc1 |
| 4-[(2-Methoxyphenyl)amino]benzoic acid |
| Benzoic acid, 4-[(2-methoxyphenyl)amino]- |
| AKR1C3 Inhibitor 5f |