Didecyl phthalate-d4 structure
|
Common Name | Didecyl phthalate-d4 | ||
|---|---|---|---|---|
| CAS Number | 1276197-18-2 | Molecular Weight | 450.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H42D4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Didecyl phthalate-d4Didecyl phthalate-d4 is the deuterium labeled Didecyl phthalate[1]. |
| Name | Didecyl phthalate-d4 |
|---|
| Description | Didecyl phthalate-d4 is the deuterium labeled Didecyl phthalate[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C28H42D4O4 |
|---|---|
| Molecular Weight | 450.69 |
| InChIKey | PGIBJVOPLXHHGS-BHGUTAGVSA-N |
| SMILES | CCCCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCCCC |