Anthra[2,1,9-def:6,5,10-d'e'f']diisochromene-1,3,8,10-tetraone structure
|
Common Name | Anthra[2,1,9-def:6,5,10-d'e'f']diisochromene-1,3,8,10-tetraone | ||
|---|---|---|---|---|
| CAS Number | 128-69-8 | Molecular Weight | 392.32 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 755.8±33.0 °C at 760 mmHg | |
| Molecular Formula | C24H8O6 | Melting Point | >300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 329.9±25.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Anthra[2,1,9-def:6,5,10-d'e'f']diisochromene-1,3,8,10-tetraonePTCDA is an organic dye molecule and an organic semiconductor[1]. |
| Name | 3,4,9,10-Perylenetetracarboxylic dianhydride |
|---|---|
| Synonym | More Synonyms |
| Description | PTCDA is an organic dye molecule and an organic semiconductor[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 755.8±33.0 °C at 760 mmHg |
| Melting Point | >300 °C(lit.) |
| Molecular Formula | C24H8O6 |
| Molecular Weight | 392.32 |
| Flash Point | 329.9±25.4 °C |
| Exact Mass | 392.032074 |
| PSA | 86.74000 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.973 |
| InChIKey | CLYVDMAATCIVBF-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2ccc3c4ccc5c6c(ccc(c7ccc1c2c73)c64)C(=O)OC5=O |
| Water Solubility | insoluble |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29173980 |
| Precursor 6 | |
|---|---|
| DownStream 9 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Pronounced polarization-induced energy level shifts at boundaries of organic semiconductor nanostructures.
Nat. Commun. 6 , 8312, (2015) Organic semiconductor devices rely on the movement of charge at and near interfaces, making an understanding of energy level alignment at these boundaries an essential element of optimizing materials ... |
|
|
Newman, C.R., et al.
Chem. Mater. 16 , 4436, (2004)
|
|
|
Optical and electrical properties of isotype crystalline molecular organic heterojunctions Forrest, S. R.; et al.
J. Appl. Phys. 66 , 5908, (1989)
|
| Perylo(3,4-cd:9,10-c'd')dipyran-1,3,8,10-tetrone |
| perylene-3,4:9,10-tetracarboxylic dianhydride |
| Pigment Red 224,PTCDA |
| Perylenetetracarboxydianhydride |
| MFCD00006916 |
| 3,4,9,10-Perylenetetracarboxylic dianhydride |
| Peryleno[10,9-cd:3,4-c'd']dipyran-1,3,8,10-tetrone |
| Pigment Red 224 |
| Red R-6418 |
| Per acid |
| Isochromeno[4',5',6':6,5,10]anthra[2,1,9-def]isochromene-1,3,8,10-tetrone |
| Perylenetetracarboxylic dianhydride |
| EINECS 204-905-3 |
| PTCDA |
| C.I.Pigment Red 224 |
| perylene-3,4,9,10-tetracarboxylic acid dianhydride |
| 3,4,9,10-Perylenetet |
| Perylene-3,4,9,10-tetracarboxylic dianhydride |
| 3,4,9,10-perylene dianhydride |
| Perylo[3,4-cd:9,10-c'd']dipyran-1,3,8,10-tetrone |