Ethyl 1-Benzylpyrrole-3-carboxylate structure
|
Common Name | Ethyl 1-Benzylpyrrole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 128259-47-2 | Molecular Weight | 229.27400 | |
| Density | 1.11 | Boiling Point | 339.811ºC at 760 mmHg | |
| Molecular Formula | C14H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.312ºC | |
| Name | Ethyl 1-Benzylpyrrole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11 |
|---|---|
| Boiling Point | 339.811ºC at 760 mmHg |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.27400 |
| Flash Point | 159.312ºC |
| Exact Mass | 229.11000 |
| PSA | 31.23000 |
| LogP | 2.71310 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | KSZAVNAKDOXZGJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccn(Cc2ccccc2)c1 |
| Safety Phrases | S24/25 |
|---|---|
| HS Code | 2933990090 |
|
~67%
Ethyl 1-Benzylp... CAS#:128259-47-2 |
| Literature: Villarreal, Carlos; Martinez, Roberto Synthesis, 2010 , # 19 art. no. M02910SS, p. 3346 - 3352 |
|
~66%
Ethyl 1-Benzylp... CAS#:128259-47-2 |
| Literature: Bonnaud; Bigg Synthesis, 1994 , vol. 1, # 5 p. 465 - 467 |
|
~10%
Ethyl 1-Benzylp... CAS#:128259-47-2 |
| Literature: Shim, Young Key; Youn, Jung In; Chun, Jae Sang; Park, Tae Ho; Kim, Moon Hwan; Kim, Wan Joo Synthesis, 1990 , # 9 p. 753 - 754 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 1-benzyl-1H-pyrrole-3-carboxylate |
| ethyl 1-benzyl-3-pyrrolecarboxylate |
| B2284 |
| 1-Benzylpyrrole-3-carboxylic Acid Ethyl Ester |