3-[(4-chlorophenyl)methylideneamino]-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione structure
|
Common Name | 3-[(4-chlorophenyl)methylideneamino]-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione | ||
|---|---|---|---|---|
| CAS Number | 135718-64-8 | Molecular Weight | 438.00800 | |
| Density | 1.4g/cm3 | Boiling Point | 556.881ºC at 760 mmHg | |
| Molecular Formula | C23H20ClN3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.592ºC | |
| Name | 3-[(4-chlorophenyl)methylideneamino]-4-phenyl-1,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 556.881ºC at 760 mmHg |
| Molecular Formula | C23H20ClN3S2 |
| Molecular Weight | 438.00800 |
| Flash Point | 290.592ºC |
| Exact Mass | 437.07900 |
| PSA | 95.00000 |
| LogP | 6.01020 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.736 |
| InChIKey | BYMOAMLNEQPJRG-AFUMVMLFSA-N |
| SMILES | S=C1Nc2sc3c(c2C(c2ccccc2)N1N=Cc1ccc(Cl)cc1)CCCC3 |
|
~77%
3-[(4-chlorophe... CAS#:135718-64-8 |
| Literature: Vega, S; Alonso, J; Diaz, JA; Junquera, F; Perez, C; et al. European Journal of Medicinal Chemistry, 1991 , vol. 26, # 3 p. 323 - 329 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (1)Benzothieno(2,3-d)pyrimidine-2(1H)-thione,3,4,5,6,7,8-hexahydro-3-(((4-chlorophenyl)methylene)amino)-4-phenyl |