5-Maleimidovaleric acid hydrazide structure
|
Common Name | 5-Maleimidovaleric acid hydrazide | ||
|---|---|---|---|---|
| CAS Number | 1286754-17-3 | Molecular Weight | 211.21800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H13N3O3 |
|---|---|
| Molecular Weight | 211.21800 |
| Exact Mass | 211.09600 |
| PSA | 95.99000 |
| LogP | 0.55010 |
| InChIKey | HGDLVVAFLRBLKJ-UHFFFAOYSA-N |
| SMILES | NNC(=O)CCCCN1C(=O)C=CC1=O |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-Maleimidovaleric acid hydrazide |
| 5-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)pentanehydrazide |