4-(4-Fluorobenzoyl)-1-methyl-1H-pyrrole-2-carbaldehyde structure
|
Common Name | 4-(4-Fluorobenzoyl)-1-methyl-1H-pyrrole-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 128843-61-8 | Molecular Weight | 231.22200 | |
| Density | 1.2 g/cm3 | Boiling Point | 395.4ºC at 760 mmHg | |
| Molecular Formula | C13H10FNO2 | Melting Point | 120-122ºC | |
| MSDS | N/A | Flash Point | 192.9ºC | |
| Name | 4-(4-Fluorobenzoyl)-1-methyl-1H-pyrrole-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2 g/cm3 |
|---|---|
| Boiling Point | 395.4ºC at 760 mmHg |
| Melting Point | 120-122ºC |
| Molecular Formula | C13H10FNO2 |
| Molecular Weight | 231.22200 |
| Flash Point | 192.9ºC |
| Exact Mass | 231.07000 |
| PSA | 39.07000 |
| LogP | 2.20770 |
| Vapour Pressure | 1.84E-06mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | GNMRXQTZWYXHMO-UHFFFAOYSA-N |
| SMILES | Cn1cc(C(=O)c2ccc(F)cc2)cc1C=O |
|
~%
4-(4-Fluorobenz... CAS#:128843-61-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 10 p. 2845 - 2849 |
|
~%
4-(4-Fluorobenz... CAS#:128843-61-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 46, # 4 p. 512 - 524 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-fluorobenzoyl)-1-methylpyrrole-2-carbaldehyde |
| MFCD00172167 |