1,5-bis(butylamino)anthracene-9,10-dione structure
|
Common Name | 1,5-bis(butylamino)anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 100693-82-1 | Molecular Weight | 350.45400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-bis(butylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H26N2O2 |
|---|---|
| Molecular Weight | 350.45400 |
| Exact Mass | 350.19900 |
| PSA | 58.20000 |
| LogP | 5.03200 |
| InChIKey | YIFQQKZGMOKOQQ-UHFFFAOYSA-N |
| SMILES | CCCCNc1cccc2c1C(=O)c1cccc(NCCCC)c1C2=O |
|
~71%
1,5-bis(butylam... CAS#:100693-82-1 |
| Literature: Huang, Hsu-Shan; Chiu, Hui-Fen; Yeh, Pen-Fong; Yuan, Chun-Lung Helvetica Chimica Acta, 2004 , vol. 87, # 4 p. 999 - 1006 |
|
~0%
1,5-bis(butylam... CAS#:100693-82-1 |
| Literature: Arai, Sadao; Kato, Seijiro; Hida, Mitsuhiko Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 5 p. 1458 - 1463 |
|
~%
Detail
|
| Literature: Mita, Katsuhisa; Yamagishi, Takamichi; Hida, Mitsuhiko Journal of the Chemical Society, Chemical Communications, 1980 , # 21 p. 1036 - 1037 |
| 1,5-Bis(n-butylamino)anthraquinone |
| 1,5-bis(butylamino)-9,10-anthraquinone |
| 1,5-Bis(butylamino)anthraquinone |
| 1,5-Di(butylamino)-9,10-anthraquinone |
| 9,10-Anthracenedione,1,5-bis(butylamino) |