Alendronate sodium structure
|
Common Name | Alendronate sodium | ||
|---|---|---|---|---|
| CAS Number | 129318-43-0 | Molecular Weight | 271.078 | |
| Density | N/A | Boiling Point | 616.7ºC at 760 mmHg | |
| Molecular Formula | C4H12NNaO7P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 326.7ºC | |
Use of Alendronate sodiumAlendronate sodium is an orally active nitrogen-containing bisphosphonate. Alendronate sodium potently inhibits bone resorption. Alendronate sodium is used for the research of postmenopausal osteoporosis[1]. |
| Name | Alendronate sodium |
|---|---|
| Synonym | More Synonyms |
| Description | Alendronate sodium is an orally active nitrogen-containing bisphosphonate. Alendronate sodium potently inhibits bone resorption. Alendronate sodium is used for the research of postmenopausal osteoporosis[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 616.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C4H12NNaO7P2 |
| Molecular Weight | 271.078 |
| Flash Point | 326.7ºC |
| Exact Mass | 270.998657 |
| PSA | 180.93000 |
| InChIKey | CAKRAHQRJGUPIG-UHFFFAOYSA-M |
| SMILES | NCCCC(O)(P(=O)([O-])O)P(=O)(O)O.[Na+] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD01861681 |
| Alendronate sodium |
| Sodium hydrogen (4-amino-1-hydroxy-1-phosphonobutyl)phosphonate |
| Alendronic acid sodium salt |
| Phosphonic acid, (4-amino-1-hydroxybutylidene)bis-, sodium salt (1:1) |
| Monosodium alendronate |
| sodium,(4-amino-1-hydroxy-1-phosphonobutyl)-hydroxyphosphinate |
| (4-Amino-1-hydroxybutylidene)bisphosphonic acid monosodium salt |