Conifegrol structure
|
Common Name | Conifegrol | ||
|---|---|---|---|---|
| CAS Number | 129350-09-0 | Molecular Weight | 316.43 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 469.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.0±28.7 °C | |
Use of ConifegrolO-Geranylconiferyl alcohol is a sesquiterpenoids? isolated from? the root of Ligularia duciformis[1]. |
| Name | 3-[4-(3,7-dimethylocta-2,6-dienoxy)-3-methoxyphenyl]prop-2-en-1-ol |
|---|---|
| Synonym | More Synonyms |
| Description | O-Geranylconiferyl alcohol is a sesquiterpenoids? isolated from? the root of Ligularia duciformis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 469.9±45.0 °C at 760 mmHg |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.43 |
| Flash Point | 238.0±28.7 °C |
| Exact Mass | 316.203857 |
| PSA | 38.69000 |
| LogP | 5.44 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | UJQXYSRVSXKEES-YIERNNEGSA-N |
| SMILES | COc1cc(C=CCO)ccc1OCC=C(C)CCC=C(C)C |
| Storage condition | ?20°C |
| 2-Propen-1-ol, 3-(4-((3,7-dimethyl-2,6-octadienyl)oxy)-3-methoxyphenyl)-, (E,E)- |
| (2E)-3-(4-{[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]oxy}-3-methoxyphenyl)-2-propen-1-ol |
| 2-Propen-1-ol, 3-[4-[[(2E)-3,7-dimethyl-2,6-octadien-1-yl]oxy]-3-methoxyphenyl]-, (2E)- |
| O-geranylconiferyl alcohol |
| (E,E)-3-(4-((3,7-Dimethyl-2,6-octadienyl)oxy)-3-methoxyphenyl)-2-propen-1-ol |