Org-9935 structure
|
Common Name | Org-9935 | ||
|---|---|---|---|---|
| CAS Number | 129425-83-8 | Molecular Weight | 304.36400 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H16N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Org-9935A potent, selective PDE3 inhibitor with IC50 of 50 nM. |
| Name | 3-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.36400 |
| Exact Mass | 304.08800 |
| PSA | 91.65000 |
| LogP | 2.49010 |
| Index of Refraction | 1.657 |
| InChIKey | KIYDKXDCNSPKQQ-UHFFFAOYSA-N |
| SMILES | COc1cc2cc(C3=NNC(=O)CC3C)sc2cc1OC |
| Org 9935 |
| Org-9935 |