5-Bromo-4-chloro-3-indoxyl caprylate structure
|
Common Name | 5-Bromo-4-chloro-3-indoxyl caprylate | ||
|---|---|---|---|---|
| CAS Number | 129541-42-0 | Molecular Weight | 372.68500 | |
| Density | 1.397g/cm3 | Boiling Point | 482.6ºC at 760mmHg | |
| Molecular Formula | C16H19BrClNO2 | Melting Point | 55-59ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (5-bromo-4-chloro-1H-indol-3-yl) octanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.397g/cm3 |
|---|---|
| Boiling Point | 482.6ºC at 760mmHg |
| Melting Point | 55-59ºC |
| Molecular Formula | C16H19BrClNO2 |
| Molecular Weight | 372.68500 |
| Exact Mass | 371.02900 |
| PSA | 42.09000 |
| LogP | 5.84970 |
| Vapour Pressure | 1.8E-09mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | QTWMXGHFXBQNEJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)Oc1c[nH]c2ccc(Br)c(Cl)c12 |
| Storage condition | -20°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Bromo-4-chloro-3-indolyl octanoate |
| Octanoic acid 5-bromo-4-chloro-1H-indol-3-yl ester |
| 5-Bromo-4-chloro-3-indolyl caprylate |
| 5-bromo-4-chloro-3-indolyl caprylate |