4'-Chloro-3'-(trifluoromethyl)acetophenone structure
|
Common Name | 4'-Chloro-3'-(trifluoromethyl)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 129825-11-2 | Molecular Weight | 222.592 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 236.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H6ClF3O | Melting Point | 61-63°C | |
| MSDS | N/A | Flash Point | 96.9±25.9 °C | |
| Name | 4'-Chloro-3'-(trifluoromethyl)acetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 236.6±35.0 °C at 760 mmHg |
| Melting Point | 61-63°C |
| Molecular Formula | C9H6ClF3O |
| Molecular Weight | 222.592 |
| Flash Point | 96.9±25.9 °C |
| Exact Mass | 222.005920 |
| PSA | 17.07000 |
| LogP | 3.55 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | UYNMUXTXDHJBEN-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| Hazard Codes | Xi,F |
|---|---|
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| Packaging Group | I |
| HS Code | 2914700090 |
|
~95%
4'-Chloro-3'-(t... CAS#:129825-11-2 |
| Literature: SMITHKLINE BEECHAM CORPORATION Patent: WO2003/101970 A1, 2003 ; Location in patent: Page 10-11 ; WO 03/101970 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4'-Chloro-3'-(trifluoromethyl)acetophenone |
| 1-[4-Chloro-3-(trifluoromethyl)phenyl]ethanone |
| Ethanone, 1-[4-chloro-3-(trifluoromethyl)phenyl]- |
| MFCD03094146 |
| 5-Acetyl-2-chlorobenzotrifluoride |
| FXFFR BG EV1 |