4'-Hydroxy-3'-(trifluoromethyl)acetophenone structure
|
Common Name | 4'-Hydroxy-3'-(trifluoromethyl)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 149105-11-3 | Molecular Weight | 204.146 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 254.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H7F3O2 | Melting Point | 176-177ºC | |
| MSDS | N/A | Flash Point | 107.8±25.9 °C | |
| Name | 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 254.7±35.0 °C at 760 mmHg |
| Melting Point | 176-177ºC |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.146 |
| Flash Point | 107.8±25.9 °C |
| Exact Mass | 204.039810 |
| PSA | 37.30000 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.476 |
| InChIKey | HKRUXZJKSFFSGF-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(O)c(C(F)(F)F)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2914700090 |
|
~%
4'-Hydroxy-3'-(... CAS#:149105-11-3 |
| Literature: US2012/184587 A1, ; |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD01091005 |
| 1-[4-Hydroxy-3-(trifluoromethyl)phenyl]ethan-1-one |
| Ethanone, 1-[4-hydroxy-3-(trifluoromethyl)phenyl]- |
| FXFFR BQ EV1 |
| 1-[4-Hydroxy-3-(trifluoromethyl)phenyl]-1-ethanone |
| 1-[4-Hydroxy-3-(trifluoromethyl)phenyl]ethanone |
| 4'-Hydroxy-3'-(trifluoromethyl)acetophenone |