cydowood structure
|
Common Name | cydowood | ||
|---|---|---|---|---|
| CAS Number | 13019-04-0 | Molecular Weight | 210.35600 | |
| Density | 0.893g/cm3 | Boiling Point | 272.4ºC at 760mmHg | |
| Molecular Formula | C14H26O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.1ºC | |
| Name | 2,4-ditert-butylcyclohexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.893g/cm3 |
|---|---|
| Boiling Point | 272.4ºC at 760mmHg |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.35600 |
| Flash Point | 111.1ºC |
| Exact Mass | 210.19800 |
| PSA | 17.07000 |
| LogP | 4.06400 |
| Vapour Pressure | 0.00608mmHg at 25°C |
| Index of Refraction | 1.457 |
| InChIKey | NYOHMJCUHOBGBN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC(=O)C(C(C)(C)C)C1 |
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
|---|---|
| Risk Phrases | 38-51/53 |
| Safety Phrases | 37-61 |
| HS Code | 2914299000 |
| HS Code | 2914299000 |
|---|---|
| Summary | 2914299000. other cyclanic, cyclenic or cyclotherpenic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2,4-Di-tert-butylcyclohexanon |
| 2,4-Di-tert-butylcyclohexanone |
| trans-2,4-Di-t-butylcyclohexanone |