2-{[3-(4-Nitrophenyl)propyl]amino}ethanol structure
|
Common Name | 2-{[3-(4-Nitrophenyl)propyl]amino}ethanol | ||
|---|---|---|---|---|
| CAS Number | 130634-09-2 | Molecular Weight | 224.256 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 397.9±27.0 °C at 760 mmHg | |
| Molecular Formula | C11H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.5±23.7 °C | |
| Name | 2-[3-(4-nitrophenyl)propylamino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 397.9±27.0 °C at 760 mmHg |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.256 |
| Flash Point | 194.5±23.7 °C |
| Exact Mass | 224.116089 |
| PSA | 78.08000 |
| LogP | 0.83 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | RGJQCMUPYAXGNG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CCCNCCO)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922199090 |
|
~82%
2-{[3-(4-Nitrop... CAS#:130634-09-2 |
| Literature: Katakami; Yokoyama; Miyamoto; Mori; Kawauchi; Nobori; San-nohe; Kaiho; Kamiya Journal of Medicinal Chemistry, 1992 , vol. 35, # 18 p. 3325 - 3330 |
|
~%
2-{[3-(4-Nitrop... CAS#:130634-09-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 35, # 18 p. 3325 - 3330 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-{[3-(4-Nitrophenyl)propyl]amino}ethanol |
| 2-((3-(4-Nitrophenyl)propyl)amino)ethanol |
| N-(2-hydroxyethyl)-N-[3-(4-nitrophenyl)propyl]amine |
| MFCD00012482 |
| Ethanol,2-[[3-(4-nitrophenyl)propyl]amino] |
| N-(2-Hydroxyethyl)-3-(4-nitrophenyl) propylamine |
| Ethanol, 2-[[3-(4-nitrophenyl)propyl]amino]- |
| AC-4713 |