Diatrizoate Meglumine structure
|
Common Name | Diatrizoate Meglumine | ||
|---|---|---|---|---|
| CAS Number | 131-49-7 | Molecular Weight | 809.127 | |
| Density | 1.9465 (estimate) | Boiling Point | 614.1ºC at 760mmHg | |
| Molecular Formula | C18H26I3N3O9 | Melting Point | 189-193° (dec) | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of Diatrizoate MeglumineDiatrizoate meglumine is the meglumine salt form of diatrizoate, an organic, iodinated, radiopaque X-ray contrast medium used in diagnostic radiography. |
| Name | meglumine amidotrizoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9465 (estimate) |
|---|---|
| Boiling Point | 614.1ºC at 760mmHg |
| Melting Point | 189-193° (dec) |
| Molecular Formula | C18H26I3N3O9 |
| Molecular Weight | 809.127 |
| Exact Mass | 808.880310 |
| PSA | 215.66000 |
| LogP | 1.44700 |
| Vapour Pressure | 6.19E-16mmHg at 25°C |
| InChIKey | MIKKOBKEXMRYFQ-WZTVWXICSA-N |
| SMILES | CC(=O)Nc1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I.CNCC(O)C(O)C(O)C(O)CO |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| RTECS | LZ4315000 |
|
In vitro immunomodulatory effects of 5-amino-3-methyl-4-isoxazolecarboxylic acid hydrazide on the cellular immune response.
Immunopharmacol. Immunotoxicol. 36(2) , 150-7, (2014) The aim of this study was to determine the immunomodulatory activity of 5-amino-3-methyl-4-isoxazolecarboxylic acid hydrazide in vitro. This compound was used for the synthesis of a series of 5-amino-... |
|
|
A misguided 'pill in the pocket' approach with flecainide leading to cardiac arrest.
BMJ Case Rep. 2012 , doi:10.1136/bcr-2012-006868, (2012)
|
|
|
The effect of 5-amino-3-methyl-4-isoxazolecarboxylic acid hydrazide on lymphocyte subsets and humoral immune response in SRBC-immunized mice.
Immunopharmacol. Immunotoxicol. 37(2) , 148-57, (2015) 5-Amino-3-methyl-4-isoxazolecarboxylic acid hydrazide is a non-cytotoxic synthetic isoxazole derivative with considerable immunomodulatory properties demonstrated in in vitro experiments. The aim of t... |
| Megluminamidotrizoat |
| Diatrizoic Acid Methylglucamine |
| MFCD00069632 |
| 3,5-bis(acetylamino)-2,4,6-triiodobenzoic acid - (2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol (1:1) |
| Meglumin-diazetrizoat |
| 1-deoxy-1-(methylamino)-D-glucitol 3,5-diacetamido-2,4,6-triiodobenzoate |
| 3,5-diacetamido-2,4,6-triiodobenzoic acid,(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| Benzoic acid, 3,5-bis(acetylamino)-2,4,6-triiodo-, compd. with D-glucitol, 1-deoxy-1-(methylamino)- (1:1) |
| Diatrizoate methylglucamine |
| Diatrizoate Meglumine |
| Hypaque meglumine |
| Renograffin |
| Meglumine amidotrizoate |
| Renografin M-76 |
| Unipaque |
| Reno M-Dip |
| 3,5-Diacetamido-2,4,6-triiodobenzoic acid - 1-deoxy-1-(methylamino)-D-glucitol (1:1) |
| Angiografin |
| D-Glucitol, 1-deoxy-1-(methylamino)-, 3,5-bis(acetylamino)-2,4,6-triiodobenzoate (salt) |
| Renurix |
| Renografin |
| Methylglucamine diatrizoate |
| acide 3,5-bis(acétylamino)-2,4,6-triiodobenzoïque - (2R,3R,4R,5S)-6-(méthylamino)hexane-1,2,3,4,5-pentol (1:1) |
| 3,5-Bis(acetylamino)-2,4,6-triiodbenzolcarbonsäure--(2R,3R,4R,5S)-6-(methylamino)hexan-1,2,3,4,5-pentol(1:1) |
| N-Methyl-D-glucamine diatrizoate |
| Amidotrizoate meglumine |
| 3,5-Bis(acetylamino)-2,4,6-triiodobenzoic Acid compd. with 1-Deoxy-1-(methylamino)-D-glucitol (1:1) |
| Urografin 76 |
| Urovist |
| EINECS 205-024-7 |
| Cystografin |
| ioxeol |
| Meglumin-diatrizoat |
| meglumine diatriazoate |
| 3,5-bis(acetylamino)-2,4,6-triiodobenzoic acid - 1-deoxy-1-(methylamino)-D-glucitol (1:1) |
| meglumine diatrizoate |
| Triombrast |
| Verografin |