1-benzofuran-2,3-dicarboxylic acid structure
|
Common Name | 1-benzofuran-2,3-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 131-76-0 | Molecular Weight | 206.15200 | |
| Density | 1.568g/cm3 | Boiling Point | 431.1ºC at 760mmHg | |
| Molecular Formula | C10H6O5 | Melting Point | 255-259ºC(lit.) | |
| MSDS | N/A | Flash Point | 214.5ºC | |
| Name | 1-benzofuran-2,3-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.568g/cm3 |
|---|---|
| Boiling Point | 431.1ºC at 760mmHg |
| Melting Point | 255-259ºC(lit.) |
| Molecular Formula | C10H6O5 |
| Molecular Weight | 206.15200 |
| Flash Point | 214.5ºC |
| Exact Mass | 206.02200 |
| PSA | 87.74000 |
| LogP | 1.82920 |
| Vapour Pressure | 3.38E-08mmHg at 25°C |
| Index of Refraction | 1.69 |
| InChIKey | FAEMVAVNTRSKEZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1oc2ccccc2c1C(=O)O |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2932999099 |
| Precursor 8 | |
|---|---|
| DownStream 8 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzofuran-dicarbonsaeure-(2.3) |
| 2,3-Benzofurandicarboxylicacid |
| Benzofuran-2,3-dicarboxylic acid |
| MFCD05863264 |
| Benzofuran-2,3-dicarbonsaeure |