N-(4-Fluorophenyl)-2-(4-hydroxyphenyl)acetamide structure
|
Common Name | N-(4-Fluorophenyl)-2-(4-hydroxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 131179-72-1 | Molecular Weight | 245.24900 | |
| Density | 1.319g/cm3 | Boiling Point | 488.1ºC at 760mmHg | |
| Molecular Formula | C14H12FNO2 | Melting Point | 139-141ºC | |
| MSDS | N/A | Flash Point | 249ºC | |
| Name | N-(4-Fluorophenyl)-2-(4-hydroxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.319g/cm3 |
|---|---|
| Boiling Point | 488.1ºC at 760mmHg |
| Melting Point | 139-141ºC |
| Molecular Formula | C14H12FNO2 |
| Molecular Weight | 245.24900 |
| Flash Point | 249ºC |
| Exact Mass | 245.08500 |
| PSA | 49.33000 |
| LogP | 2.78550 |
| Vapour Pressure | 3.77E-10mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | NPQFAGAPBOEXHZ-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccc(O)cc1)Nc1ccc(F)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~%
N-(4-Fluorophen... CAS#:131179-72-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 34, # 2 p. 752 - 757 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| n-(4-fluorophenyl)-2-(4-hydroxyphenyl)acetamide |