5-(3-NITRO-PHENYL)-FURAN-2-CARBOXYLIC ACID structure
|
Common Name | 5-(3-NITRO-PHENYL)-FURAN-2-CARBOXYLIC ACID | ||
|---|---|---|---|---|
| CAS Number | 13130-13-7 | Molecular Weight | 233.17700 | |
| Density | 1.44g/cm3 | Boiling Point | 450.2ºC at 760 mmHg | |
| Molecular Formula | C11H7NO5 | Melting Point | 252-260 °C(lit.) | |
| MSDS | USA | Flash Point | 226.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-(3-nitrophenyl)furan-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 450.2ºC at 760 mmHg |
| Melting Point | 252-260 °C(lit.) |
| Molecular Formula | C11H7NO5 |
| Molecular Weight | 233.17700 |
| Flash Point | 226.1ºC |
| Exact Mass | 233.03200 |
| PSA | 96.26000 |
| LogP | 3.07620 |
| Vapour Pressure | 6.83E-09mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | XWQLGLUTQIKSAJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932190090 |
|
~43%
5-(3-NITRO-PHEN... CAS#:13130-13-7 |
| Literature: Russian Journal of Organic Chemistry, , vol. 45, # 4 p. 541 - 550 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
Development of hydrogel TentaGel shell-core beads for ultrahigh throughput solution-phase screening of encoded OBOC combinatorial small molecule libraries.
J. Comb. Chem. 11 , 91-102, (2009) The one-bead one-compound (OBOC) combinatorial library method enables the rapid generation and screening of millions of discrete chemical compounds on beads. Most of the OBOC screening methods require... |
| 5-(3-Nitrophenyl)-2-furoic acid |
| 5-(3-Nitro-phenyl)-furan-2-carboxylic acid |
| 5-<3-Nitro-phenyl>-furan-2-carbonsaeure |
| MFCD00778533 |
| 5-(3-nitrophenyl)-furoic acid |
| 5-(3-Nitrophenyl)-2-furancarboxylic acid |