SC-1 structure
|
Common Name | SC-1 | ||
|---|---|---|---|---|
| CAS Number | 1313019-65-6 | Molecular Weight | 431.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H13ClF3N3O2 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | SC-1 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H13ClF3N3O2 |
|---|---|
| Molecular Weight | 431.8 |
| InChIKey | HVPZDXDXIQZKHU-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)cc1 |
| Storage condition | 2-8°C |
|
Integrin-specific hydrogels as adaptable tumor organoids for malignant B and T cells.
Biomaterials 73 , 110-9, (2015) Non-Hodgkin lymphomas are a heterogeneous group of lymphoproliferative disorders of B and T cell origin that are treated with chemotherapy drugs with variable success rate that has virtually not chang... |
| SC-1 |