N,N-DIETHYL-3,6-DIFLUOROPHTHALAMIC ACID structure
|
Common Name | N,N-DIETHYL-3,6-DIFLUOROPHTHALAMIC ACID | ||
|---|---|---|---|---|
| CAS Number | 131401-56-4 | Molecular Weight | 257.23300 | |
| Density | 1.294g/cm3 | Boiling Point | 417ºC at 760 mmHg | |
| Molecular Formula | C12H13F2NO3 | Melting Point | 163-165ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 206ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(diethylcarbamoyl)-3,6-difluorobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 417ºC at 760 mmHg |
| Melting Point | 163-165ºC(lit.) |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.23300 |
| Flash Point | 206ºC |
| Exact Mass | 257.08600 |
| PSA | 57.61000 |
| LogP | 2.14500 |
| Vapour Pressure | 1.06E-07mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | DYPGXWRGWRATMM-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)c1c(F)ccc(F)c1C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Hydrolysis of naptalam and structurally related amides: inhibition by dissolved metal ions and metal (hydr)oxide surfaces.
J. Agric. Food Chem. 47(10) , 4425-34, (1999) In metal ion-free solutions, the secondary amide naptalam hydrolyzes more rapidly as the pH is decreased; intramolecular nucleophilic attack by a carboxylate side group is very likely involved. Millim... |
| 2-<(diethylamino)carbonyl>-3,6-difluorobenzoic acid |
| N,N-Diethyl-3,6-difluorophthalamic acid |
| 2-[diethylamino]carbonyl-3,6-benzoic acid |
| MFCD00134474 |