3,6-Difluorophthalic acid structure
|
Common Name | 3,6-Difluorophthalic acid | ||
|---|---|---|---|---|
| CAS Number | 651-97-8 | Molecular Weight | 202.112 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 357.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H4F2O4 | Melting Point | 184°C | |
| MSDS | N/A | Flash Point | 169.7±27.9 °C | |
| Name | 3,6-Difluorophthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 357.0±42.0 °C at 760 mmHg |
| Melting Point | 184°C |
| Molecular Formula | C8H4F2O4 |
| Molecular Weight | 202.112 |
| Flash Point | 169.7±27.9 °C |
| Exact Mass | 202.007767 |
| PSA | 74.60000 |
| LogP | 1.23 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | VFLMWMTWWZGXGA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(F)ccc(F)c1C(=O)O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37 |
| HS Code | 2917399090 |
|
~%
3,6-Difluoropht... CAS#:651-97-8 |
| Literature: Synthetic Communications, , vol. 20, # 14 p. 2139 - 2146 |
|
~%
3,6-Difluoropht... CAS#:651-97-8 |
| Literature: Synthetic Communications, , vol. 20, # 14 p. 2139 - 2146 |
|
~%
3,6-Difluoropht... CAS#:651-97-8 |
| Literature: Synthetic Communications, , vol. 20, # 14 p. 2139 - 2146 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| QVR BF EF FVQ |
| 3,6-Difluorophthalic acid |
| MFCD03840499 |
| 3,6-difluorobenzene-1,2-dicarboxylic acid |