Benzenesulfonamide,N-(dimethyl-l4-sulfanylidene)-4-methyl structure
|
Common Name | Benzenesulfonamide,N-(dimethyl-l4-sulfanylidene)-4-methyl | ||
|---|---|---|---|---|
| CAS Number | 13150-75-9 | Molecular Weight | 231.33500 | |
| Density | 1.26g/cm3 | Boiling Point | 389.4ºC at 760mmHg | |
| Molecular Formula | C9H13NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.3ºC | |
| Name | N-(dimethyl-λ4-sulfanylidene)-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 389.4ºC at 760mmHg |
| Molecular Formula | C9H13NO2S2 |
| Molecular Weight | 231.33500 |
| Flash Point | 189.3ºC |
| Exact Mass | 231.03900 |
| PSA | 74.09000 |
| LogP | 3.47660 |
| Vapour Pressure | 6.4E-06mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | XXOIGDFCELVFFJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N=S(C)C)cc1 |
| Precursor 8 | |
|---|---|
| DownStream 5 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| S,S-dimethyl-N-p-tolylsulphonylsulphimide |
| S,S-dimethyl-N-p-tolylsulfonylsulfimine |