(+)-Pteryxin structure
|
Common Name | (+)-Pteryxin | ||
|---|---|---|---|---|
| CAS Number | 13161-75-6 | Molecular Weight | 386.395 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 486.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H22O7 | Melting Point | 81℃ | |
| MSDS | N/A | Flash Point | 211.5±28.8 °C | |
Use of (+)-PteryxinPteryxin, a coumarin in Peucedanum japonicum Thunb leaves, exerts antiobesity activity[1]. Pteryxin is a potent butyrylcholinesterase (BChE) inhibitor, with an IC50 of 12.96 μg/ml[2]. |
| Name | [(9R,10R)-9-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Description | Pteryxin, a coumarin in Peucedanum japonicum Thunb leaves, exerts antiobesity activity[1]. Pteryxin is a potent butyrylcholinesterase (BChE) inhibitor, with an IC50 of 12.96 μg/ml[2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 486.8±45.0 °C at 760 mmHg |
| Melting Point | 81℃ |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.395 |
| Flash Point | 211.5±28.8 °C |
| Exact Mass | 386.136566 |
| PSA | 92.04000 |
| LogP | 4.30 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | LYUZYPKZQDYMEE-YRCPKEQFSA-N |
| SMILES | CC=C(C)C(=O)OC1c2c(ccc3ccc(=O)oc23)OC(C)(C)C1OC(C)=O |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi |
|---|
| 3'-O-angeloyl-4'-acetyl-cis-khellactone |
| (9R,10R)-9-Acetoxy-8,8-dimethyl-2-oxo-9,10-dihydro-2H,8H-pyrano[2,3-f]chromen-10-yl (2Z)-2-methyl-2-butenoate |
| Pterixin |
| (9R,10R)-9-Acetoxy-8,8-dimethyl-2-oxo-9,10-dihydro-2H,8H-pyrano[2,3-f]chromen-10-yl (2Z)-2-methylbut-2-enoate |
| Bio-0315 |
| HMS2205E19 |
| Pteryxin |