Bergaptol-beta-glucopyranoside structure
|
Common Name | Bergaptol-beta-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 131623-13-7 | Molecular Weight | 364.30400 | |
| Density | 1.647g/cm3 | Boiling Point | 690.1ºC at 760mmHg | |
| Molecular Formula | C17H16O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 371.2ºC | |
Use of Bergaptol-beta-glucopyranosideBergaptol O-β-D-glucopyranoside possesses anti-gastric ulcer and anti-cancer effect[1]. |
| Name | 4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyfuro[3,2-g]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Description | Bergaptol O-β-D-glucopyranoside possesses anti-gastric ulcer and anti-cancer effect[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.647g/cm3 |
|---|---|
| Boiling Point | 690.1ºC at 760mmHg |
| Molecular Formula | C17H16O9 |
| Molecular Weight | 364.30400 |
| Flash Point | 371.2ºC |
| Exact Mass | 364.07900 |
| PSA | 142.73000 |
| Vapour Pressure | 5.39E-20mmHg at 25°C |
| Index of Refraction | 1.701 |
| InChIKey | CVAHFYWRHVOEBA-AQFIFQLPSA-N |
| SMILES | O=c1ccc2c(OC3OC(CO)C(O)C(O)C3O)c3ccoc3cc2o1 |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| Bergaptol-O-glucopyranoside |