2-Propanone,O-(2,4-dinitrophenyl)oxime structure
|
Common Name | 2-Propanone,O-(2,4-dinitrophenyl)oxime | ||
|---|---|---|---|---|
| CAS Number | 13181-10-7 | Molecular Weight | 239.18500 | |
| Density | 1.41g/cm3 | Boiling Point | 366.5ºC at 760mmHg | |
| Molecular Formula | C9H9N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.4ºC | |
| Name | N-(2,4-dinitrophenoxy)propan-2-imine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 366.5ºC at 760mmHg |
| Molecular Formula | C9H9N3O5 |
| Molecular Weight | 239.18500 |
| Flash Point | 175.4ºC |
| Exact Mass | 239.05400 |
| PSA | 113.23000 |
| LogP | 3.32400 |
| Vapour Pressure | 3.08E-05mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | FRNRURMYMBFWLM-UHFFFAOYSA-N |
| SMILES | CC(C)=NOc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| acetone-[O-(2,4-dinitro-phenyl)-oxime ] |
| Aceton-[O-(2,4-dinitro-phenyl)-oxim] |
| O-(2,4-dinitrophenyl)propanoneoxime |
| Acetonoxim-(2.4-dinitro-phenyl)-aether |
| 2,4-dinitrophenyl ether of acetone oxime |
| O-(2,4-dinitrophenyl)acetoxime |
| acetone O2-(2,4-dinitrophenyl)oxime |
| O-(2,4-Dinitro-phenyl)-N-isopropyliden-hydroxylamin |