BI1002494 structure
|
Common Name | BI1002494 | ||
|---|---|---|---|---|
| CAS Number | 1319738-39-0 | Molecular Weight | 423.462 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 609.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H25N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.5±31.5 °C | |
Use of BI1002494BI1002494 (BI-1002494) is a novel, potent, and selective spleen tyrosine kinase (SYK) inhibitor with enzyme IC50 of 30 nM, cell IC50 of 7 nM (FcεR1-mediated histamine release in human monocyte-derived mast cells, in the presence of 0.1% albumin). |
| Name | (4R)-4-[(1R)-1-{[7-(3,4,5-Trimethoxyphenyl)-1,6-naphthyridin-5-yl]oxy}ethyl]-2-pyrrolidinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 609.6±55.0 °C at 760 mmHg |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.462 |
| Flash Point | 322.5±31.5 °C |
| Exact Mass | 423.179413 |
| LogP | 0.95 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | BRYUNLVJDCMANZ-UKRRQHHQSA-N |
| SMILES | COc1cc(-c2cc3ncccc3c(OC(C)C3CNC(=O)C3)n2)cc(OC)c1OC |
| (4R)-4-[(1R)-1-{[7-(3,4,5-Trimethoxyphenyl)-1,6-naphthyridin-5-yl]oxy}ethyl]-2-pyrrolidinone |
| 2-Pyrrolidinone, 4-[(1R)-1-[[7-(3,4,5-trimethoxyphenyl)-1,6-naphthyridin-5-yl]oxy]ethyl]-, (4R)- |