N-Benzoyl-(2R,3S)-3-phenylisoserine structure
|
Common Name | N-Benzoyl-(2R,3S)-3-phenylisoserine | ||
|---|---|---|---|---|
| CAS Number | 132201-33-3 | Molecular Weight | 285.29500 | |
| Density | 1.316g/cm3 | Boiling Point | 580.7ºC at 760 mmHg | |
| Molecular Formula | C16H15NO4 | Melting Point | 169-172 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 305ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of N-Benzoyl-(2R,3S)-3-phenylisoserineN-Benzoyl-(2R,3S)-3-phenylisoserine is a Taxol C-13 Side Chain and crucial for the strong antitumor activity of Taxol[1]. |
| Name | (2R,3S)-N-Benzoyl-3-phenyl Isoserine |
|---|---|
| Synonym | More Synonyms |
| Description | N-Benzoyl-(2R,3S)-3-phenylisoserine is a Taxol C-13 Side Chain and crucial for the strong antitumor activity of Taxol[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 580.7ºC at 760 mmHg |
| Melting Point | 169-172 °C(lit.) |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.29500 |
| Flash Point | 305ºC |
| Exact Mass | 285.10000 |
| PSA | 86.63000 |
| LogP | 1.99410 |
| Vapour Pressure | 2.51E-14mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | HYJVYOWKYPNSTK-UONOGXRCSA-N |
| SMILES | O=C(NC(c1ccccc1)C(O)C(=O)O)c1ccccc1 |
| Storage condition | -20℃ |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
|
Kingston, D.G.I. et al.
J. Nat. Prod. 53 , 1, (1990)
|
|
|
Mangatal, L. et al.
Tetrahedron 45 , 4177, (1989)
|
|
|
Borman, S.
Chem. Eng. News 69(35) , 11, (1991)
|
| (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoic acid |
| MFCD00274633 |