2-Amino-4-[(3,4-diaminophenyl)sulfonyl]phenylamine structure
|
Common Name | 2-Amino-4-[(3,4-diaminophenyl)sulfonyl]phenylamine | ||
|---|---|---|---|---|
| CAS Number | 13224-79-8 | Molecular Weight | 278.33000 | |
| Density | 1.489g/cm3 | Boiling Point | 631.1ºC at 760mmHg | |
| Molecular Formula | C12H14N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 335.5ºC | |
| Name | 2-Amino-4-[(3,4-diaminophenyl)sulfonyl]phenylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.489g/cm3 |
|---|---|
| Boiling Point | 631.1ºC at 760mmHg |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.33000 |
| Flash Point | 335.5ºC |
| Exact Mass | 278.08400 |
| PSA | 146.60000 |
| LogP | 4.25380 |
| Vapour Pressure | 7.75E-16mmHg at 25°C |
| Index of Refraction | 1.731 |
| InChIKey | JKETWUADWJKEKN-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(N)c(N)c2)cc1N |
| HS Code | 2921590090 |
|---|
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(3,4-diaminophenyl)sulfonylbenzene-1,2-diamine |