ethyl 2-(2-methyl-4-nitro-imidazol-1-yl)acetate structure
|
Common Name | ethyl 2-(2-methyl-4-nitro-imidazol-1-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 13230-22-3 | Molecular Weight | 213.19100 | |
| Density | 1.36g/cm3 | Boiling Point | 387.3ºC at 760mmHg | |
| Molecular Formula | C8H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188ºC | |
| Name | ethyl 2-(2-methyl-4-nitroimidazol-1-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 387.3ºC at 760mmHg |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19100 |
| Flash Point | 188ºC |
| Exact Mass | 213.07500 |
| PSA | 89.94000 |
| LogP | 1.18600 |
| Vapour Pressure | 3.33E-06mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | XMPREPGUGSKZIE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cn1cc([N+](=O)[O-])nc1C |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Ethoxycarbonylmethyl-2-methyl-4-nitro-imidazol |
| 2-Methyl-4-nitroimidazole-1-acetic acid ethyl ester |
| IMIDAZOLE-1-ACETIC ACID,2-METHYL-4-NITRO-,ETHYL ESTER |
| 1-ethoxycarbonylmethyl-2-methyl-4-nitroimidazole |
| ethyl 2-methyl-4-nitroimidazole-1-acetate |