Faltan-d4 structure
|
Common Name | Faltan-d4 | ||
|---|---|---|---|---|
| CAS Number | 1327204-12-5 | Molecular Weight | 300.582 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 333.8±52.0 °C at 760 mmHg | |
| Molecular Formula | C9D4Cl3NO2S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 155.7±30.7 °C | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Warning | |
Use of Faltan-d4Faltan-d4 is the deuterium labeled Faltan[1]. Faltan is a dicarboximide fungicide, widely used on vines and several vegetable crops, and is also cytotoxic effect on human bronchial epithelial cells[2]. |
| Name | Folpet-d4 |
|---|---|
| Synonym | More Synonyms |
| Description | Faltan-d4 is the deuterium labeled Faltan[1]. Faltan is a dicarboximide fungicide, widely used on vines and several vegetable crops, and is also cytotoxic effect on human bronchial epithelial cells[2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 333.8±52.0 °C at 760 mmHg |
| Molecular Formula | C9D4Cl3NO2S |
| Molecular Weight | 300.582 |
| Flash Point | 155.7±30.7 °C |
| Exact Mass | 298.927948 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | HKIOYBQGHSTUDB-RHQRLBAQSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1SC(Cl)(Cl)Cl |
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H319-H332-H351-H400 |
| Precautionary Statements | P261-P273-P280-P304 + P340 + P312-P333 + P313 |
| RIDADR | UN 3077 9 / PGIII |
| n-(trichloromethylthio)phthalimide |
| 1H-Isoindole-1,3(2H)-dione-4,5,6,7-d, 2-[(trichloromethyl)thio]- |
| 2-[(Trichloromethyl)sulfanyl](H)-1H-isoindole-1,3(2H)-dione |
| 4,5,6,7-tetradeuterio-2-(trichloromethylsulfanyl)isoindoline-1,3-dione |
| Folpet-d4 |