3-Bromo-9,10-phenanthrenedione structure
|
Common Name | 3-Bromo-9,10-phenanthrenedione | ||
|---|---|---|---|---|
| CAS Number | 13292-05-2 | Molecular Weight | 287.108 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 446.8±24.0 °C at 760 mmHg | |
| Molecular Formula | C14H7BrO2 | Melting Point | 267-268℃ | |
| MSDS | N/A | Flash Point | 162.1±9.4 °C | |
| Name | 3-Bromophenanthrene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 446.8±24.0 °C at 760 mmHg |
| Melting Point | 267-268℃ |
| Molecular Formula | C14H7BrO2 |
| Molecular Weight | 287.108 |
| Flash Point | 162.1±9.4 °C |
| Exact Mass | 285.962921 |
| PSA | 34.14000 |
| LogP | 3.90 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | OFVPOKPVPJPQAY-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)c2ccc(Br)cc2-c2ccccc21 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| QC-1271 |
| 3-Brom-phenanthrenchinon |
| 3-Brom-phenanthren-9,10-dion |
| 3-bromo-phenanthrene-9,10-dione |
| C14H7O2(3-Br) |
| 3-Bromo-9,10-phenanthrenedione |
| 9,10-Phenanthrenedione, 3-bromo- |