Sodium tetraborate structure
|
Common Name | Sodium tetraborate | ||
|---|---|---|---|---|
| CAS Number | 1330-43-4 | Molecular Weight | 201.219 | |
| Density | 2.367 g/mL at 25 °C(lit.) | Boiling Point | 1575°C | |
| Molecular Formula | B4Na2O7 | Melting Point | 741 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 1575°C | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | disodium tetraborate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.367 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 1575°C |
| Melting Point | 741 °C(lit.) |
| Molecular Formula | B4Na2O7 |
| Molecular Weight | 201.219 |
| Flash Point | 1575°C |
| Exact Mass | 201.981171 |
| PSA | 92.27000 |
| Index of Refraction | 1.501 |
| InChIKey | UQGFMSUEHSUPRD-UHFFFAOYSA-N |
| SMILES | [Na+].[Na+].[O-]B1OB2OB([O-])OB(O1)O2 |
| Stability | Stable. Incompatible with powdered metals. |
| Water Solubility | 26 g/L (20 ºC) |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H319-H360FD |
| Precautionary Statements | P201-P280-P305 + P351 + P338-P308 + P313 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn: Harmful;Xi: Irritant; |
| Risk Phrases | R62 |
| Safety Phrases | 36/37-24/25-26-36-23 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 1 |
| RTECS | ED4588000 |
| HS Code | 2840200000 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2840200000 |
|---|
|
G-quadruplex conformation and dynamics are determined by loop length and sequence.
Nucleic Acids Res. 42(12) , 8106-14, (2014) The quadruplex forming G-rich sequences are unevenly distributed throughout the human genome. Their enrichment in oncogenic promoters and telomeres has generated interest in targeting G-quadruplex (GQ... |
|
|
CRL4(RBBP7) is required for efficient CENP-A deposition at centromeres.
J. Cell Sci. 128 , 1732-45, (2015) The mitotic spindle drives chromosome movement during mitosis and attaches to chromosomes at dedicated genomic loci named centromeres. Centromeres are epigenetically specified by their histone composi... |
|
|
Use of ion-pairing reagent for improving iodine speciation analysis in seaweed by pressure-driven capillary electrophoresis and ultraviolet detection.
J. Chromatogr. A. 1379 , 112-7, (2015) This study achieved resolution improvement for iodine speciation in the presence of an ion-pairing reagent by a pressure-driven capillary electrophoresis (CE) system. Addition of 0.01mM tetrabutyl amm... |
| boricin |
| MFCD00081185 |
| borascu |
| sodium tetrabotare |
| EINECS 215-540-4 |
| Sodium tetraborate |
| bura |
| BoraxNf |
| 2,4,6,8,9-Pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane-3,7-diolate, sodium salt (1:2) |
| UNII-8191EN8ZMD |
| Disodium tetraborate |
| Disodium bicyclo[3.3.1]tetraboroxane-3,7-diolate |
| jaikin |
| BORAX |
| solubor |