Ramifenazone-d7 structure
|
Common Name | Ramifenazone-d7 | ||
|---|---|---|---|---|
| CAS Number | 1330180-51-2 | Molecular Weight | 252.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12D7N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ramifenazone-d7Ramifenazone-d7 (Isopropylaminoantipyrine-d7) is the deuterium labeled Ramifenazone. Ramifenazone (Isopropylaminoantipyrine) is a pyrazole derivative and acts as a non-steroidal anti-inflammatory agent (NSAID). Ramifenazone has analgesic, antipyretic, anti-inflammatory and antimicrobial activities[1][2]. |
| Name | Ramifenazone-d7 |
|---|
| Description | Ramifenazone-d7 (Isopropylaminoantipyrine-d7) is the deuterium labeled Ramifenazone. Ramifenazone (Isopropylaminoantipyrine) is a pyrazole derivative and acts as a non-steroidal anti-inflammatory agent (NSAID). Ramifenazone has analgesic, antipyretic, anti-inflammatory and antimicrobial activities[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C14H12D7N3O |
|---|---|
| Molecular Weight | 252.36 |
| InChIKey | XOZLRRYPUKAKMU-SVMCCORHSA-N |
| SMILES | Cc1c(NC(C)C)c(=O)n(-c2ccccc2)n1C |