Quetiapine Sulfoxide-d8 structure
|
Common Name | Quetiapine Sulfoxide-d8 | ||
|---|---|---|---|---|
| CAS Number | 1330238-38-4 | Molecular Weight | 407.56 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H17D8N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Quetiapine Sulfoxide-d8Quetiapine Sulfoxide-d8 (Quetiapine S-oxide-d8) is the deuterium labeled Quetiapine sulfoxide. Quetiapine sulfoxide (Quetiapine S-oxide) is a main metabolite of Quetiapinem. Quetiapine is a second-generation antipsychotic[1]. Quetiapine is a 5-HT receptors agonist and a dopamine receptor antagonist[1][2]. |
| Name | Quetiapine Sulfoxide-d8 |
|---|
| Description | Quetiapine Sulfoxide-d8 (Quetiapine S-oxide-d8) is the deuterium labeled Quetiapine sulfoxide. Quetiapine sulfoxide (Quetiapine S-oxide) is a main metabolite of Quetiapinem. Quetiapine is a second-generation antipsychotic[1]. Quetiapine is a 5-HT receptors agonist and a dopamine receptor antagonist[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C21H17D8N3O3S |
|---|---|
| Molecular Weight | 407.56 |
| InChIKey | FXJNLPUSSHEDON-PMCMNDOISA-N |
| SMILES | O=S1c2ccccc2N=C(N2CCN(CCOCCO)CC2)c2ccccc21 |