Quetiapine Sulfoxide structure
|
Common Name | Quetiapine Sulfoxide | ||
|---|---|---|---|---|
| CAS Number | 329216-63-9 | Molecular Weight | 399.507 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 611.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C21H25N3O3S | Melting Point | -48ºC | |
| MSDS | N/A | Flash Point | 323.5±34.3 °C | |
Use of Quetiapine SulfoxideQuetiapine sulfoxide is a metabolite of Quetiapine, which is an atypical antipsychotic compound. |
| Name | Quetiapine Sulfoxide |
|---|---|
| Synonym | More Synonyms |
| Description | Quetiapine sulfoxide is a metabolite of Quetiapine, which is an atypical antipsychotic compound. |
|---|---|
| Related Catalog |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 611.3±65.0 °C at 760 mmHg |
| Melting Point | -48ºC |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.507 |
| Flash Point | 323.5±34.3 °C |
| Exact Mass | 399.161652 |
| PSA | 84.58000 |
| LogP | -0.51 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | FXJNLPUSSHEDON-UHFFFAOYSA-N |
| SMILES | O=S1c2ccccc2N=C(N2CCN(CCOCCO)CC2)c2ccccc21 |
| Storage condition | 2-8℃ |
| Ethanol, 2-[2-[4-(5-oxidodibenzo[b,f][1,4]thiazepin-11-yl)-1-piperazinyl]ethoxy]- |
| 2-{2-[4-(5-Oxidodibenzo[b,f][1,4]thiazepin-11-yl)piperazin-1-yl]ethoxy}ethanol |
| 2-[2-[4-(11-oxobenzo[b][1,4]benzothiazepin-6-yl)piperazin-1-yl]ethoxy]ethanol |
| 2-{2-[4-(5-Oxidodibenzo[b,f][1,4]thiazepin-11-yl)-1-piperazinyl]ethoxy}ethanol |
| Quetiapine metabolite Quetiapine sulfoxide |
| Quetiapine Impurity 13 |