6-Acetyl-1,3-benzothiazol-2(3H)-one structure
|
Common Name | 6-Acetyl-1,3-benzothiazol-2(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 133044-44-7 | Molecular Weight | 193.222 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H7NO2S | Melting Point | 190-194ºC | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-acetyl-3H-1,3-benzothiazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Melting Point | 190-194ºC |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.222 |
| Exact Mass | 193.019745 |
| PSA | 78.17000 |
| LogP | 1.21 |
| Index of Refraction | 1.635 |
| InChIKey | UFRAIEFXNRTICG-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2[nH]c(=O)sc2c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934200090 |
|
~68%
6-Acetyl-1,3-be... CAS#:133044-44-7 |
| Literature: Phosphorus, Sulfur and Silicon and the Related Elements, , vol. 177, # 11 p. 2633 - 2638 |
|
~65%
6-Acetyl-1,3-be... CAS#:133044-44-7 |
| Literature: Tetrahedron Letters, , vol. 53, # 20 p. 2511 - 2513 |
|
~88%
6-Acetyl-1,3-be... CAS#:133044-44-7 |
| Literature: Phosphorus, Sulfur and Silicon and the Related Elements, , vol. 178, # 8 p. 1703 - 1708 |
|
~60%
6-Acetyl-1,3-be... CAS#:133044-44-7 |
| Literature: Journal of Organic Chemistry, , vol. 59, # 6 p. 1574 - 1576 |
|
~%
6-Acetyl-1,3-be... CAS#:133044-44-7 |
| Literature: Tetrahedron, , vol. 54, # 9 p. 1763 - 1772 |
| HS Code | 2934200090 |
|---|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2(3H)-Benzothiazolone, 6-acetyl- |
| 6-acetyl-2-benzothiazolinone |
| 6-Acetylbenzo[d]thiazol-2(3H)-one |
| 6-acetyl-3H-benzthiazole-2-one |
| 6-Acetyl-1,3-benzothiazol-2(3H)-one |
| 6-acetylbenzothiazolinone |
| 6-acetyl-2(3H)-benzothiazolone |
| 6-ACETYL-2-BENZOTHIAZOLONE |
| MFCD02660572 |
| 6-Acetylbenzothiazolin-2-one |