Boc-Hynic structure
|
Common Name | Boc-Hynic | ||
|---|---|---|---|---|
| CAS Number | 133081-25-1 | Molecular Weight | 253.255 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.255 |
| Exact Mass | 253.106262 |
| PSA | 100.55000 |
| LogP | 0.42 |
| Index of Refraction | 1.586 |
| InChIKey | DBNGJNCAXKNLLQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NNc1ccc(C(=O)O)cn1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~95%
Boc-Hynic CAS#:133081-25-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 19, # 16 p. 4764 - 4767 |
|
~%
Boc-Hynic CAS#:133081-25-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 12 p. 3440 - 3444 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-[2-(tert-butoxycarbonyl)hydrazinyl]pyridine-3-carboxylic acid |
| 6-tert-butoxycarbonyl-hydrazinopyridine-3-carboxylic acid |
| Boc-Hynic |
| 6-[2-(tert-Butoxycarbonyl)hydrazino]nicotinic acid |
| 6-BOC-hydrazinopyridine-3-carboxylic acid |
| 6-(2-{[(2-Methyl-2-propanyl)oxy]carbonyl}hydrazino)nicotinic acid |
| 6-Boc-hydrazinonicotinic acid |
| 3-Pyridinecarboxylic acid, 6-[2-[(1,1-dimethylethoxy)carbonyl]hydrazinyl]- |