Peonidin chloride structure
|
Common Name | Peonidin chloride | ||
|---|---|---|---|---|
| CAS Number | 134-01-0 | Molecular Weight | 336.72400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13ClO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Peonidin chloridePeonidin chloride is an O-methylated anthocyanidin that functions as a primary plant pigment, endowing purplish-red hues to flowers such as the peony, from which it takes its name, as well as berries and vegetables. Peonidin chloride exhibits chemopreventive, as well as anti-inflammatory activities on cancer cells in vitro, blocking COX-2 expression and transformation in JB6 P+ mouse epidermal cells. |
| Name | peonidin |
|---|---|
| Synonym | More Synonyms |
| Description | Peonidin chloride is an O-methylated anthocyanidin that functions as a primary plant pigment, endowing purplish-red hues to flowers such as the peony, from which it takes its name, as well as berries and vegetables. Peonidin chloride exhibits chemopreventive, as well as anti-inflammatory activities on cancer cells in vitro, blocking COX-2 expression and transformation in JB6 P+ mouse epidermal cells. |
|---|---|
| Related Catalog | |
| Target |
COX-2 |
| Molecular Formula | C16H13ClO6 |
|---|---|
| Molecular Weight | 336.72400 |
| Exact Mass | 336.04000 |
| PSA | 103.29000 |
| LogP | 0.21590 |
| InChIKey | OGBSHLKSHNAPEW-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O)ccc1O.[Cl-] |
| Storage condition | -20C |
| WGK Germany | 3 |
|---|---|
| HS Code | 2909499000 |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| UNII-D0O766G47B |
| 3,4',5,7-tetrahydroxy-3'-methoxyflavylium chloride |
| 3'-methoxy-4',3,5,7-tetrahydroxyflavylium chloride |
| Peonidin |
| 3'-methoxy-4',3,5,7-tetrahydroxyanthocyanidin chloride |
| 3,4',5,7-tetrahydroxy-3'-methoxy-2-phenylbenzopyrylium chloride |
| 3,5,7,4'-tetrahydroxy-3'-methoxyflavylium chloride |
| MFCD00017587 |
| 2-(4-hydroxy-3-methoxyphenyl)chromenylium-3,5,7-triol,chloride |
| EINECS 205-125-6 |