1-(3-chlorophenyl)-2-phenyl-ethane-1,2-dione structure
|
Common Name | 1-(3-chlorophenyl)-2-phenyl-ethane-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 7498-72-8 | Molecular Weight | 244.67300 | |
| Density | 1.272g/cm3 | Boiling Point | 389.7ºC at 760 mmHg | |
| Molecular Formula | C14H9ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.8ºC | |
| Name | 1-(3-chlorophenyl)-2-phenylethane-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 389.7ºC at 760 mmHg |
| Molecular Formula | C14H9ClO2 |
| Molecular Weight | 244.67300 |
| Flash Point | 164.8ºC |
| Exact Mass | 244.02900 |
| PSA | 34.14000 |
| LogP | 3.40560 |
| Index of Refraction | 1.603 |
| InChIKey | QNWDCWUUOFHMHH-UHFFFAOYSA-N |
| SMILES | O=C(C(=O)c1cccc(Cl)c1)c1ccccc1 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| m-Chlorbenzil |
| m-Chlorobenzil |
| 3-Chlor-benzil |
| 3-chloro-benzil |