2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid
![2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid Structure](https://image.chemsrc.com/caspic/268/13402-97-6.png)
2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid structure
|
Common Name | 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 13402-97-6 | Molecular Weight | 264.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H24O3 |
|---|---|
| Molecular Weight | 264.36000 |
| Exact Mass | 264.17300 |
| PSA | 46.53000 |
| LogP | 3.86380 |
| InChIKey | GPLFPJQMVKFQMK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCC(=O)O)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 0 | |
CAS#:140-66-9
CAS#:79-11-8
CAS#:107-39-1
CAS#:122-59-8
CAS#:108-95-2
CAS#:6111-88-2
CAS#:62574-65-6
CAS#:873393-29-4
CAS#:79-08-3
CAS#:1068-52-6This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of glycolic acid oxidase (unknown origin) assessed as enzyme-mediated redu...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3252910
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| [4-(1,1,3,3-tetramethyl-butyl)-phenoxy]-acetic acid |
| 4-tert-octylphenol monocarboxylate |
| 2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]acetic acid |
| [4-(1,1,3,3-Tetramethyl-butyl)-phenoxy]-essigsaeure |
| 4-tert-octylphenoxy acetic acid |
| O-[4-(1.1.3.3-Tetramethyl-butyl)-phenyl]-glykolsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid? |
| A: SMILES notation of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid is CC(C)(C)CC(C)(C)c1ccc(OCC(=O)O)cc1. |
| Q: What is the Chinese name of 13402-97-6? |
| A: Chinese name of 13402-97-6 is 13402-97-6. |
| Q: What is the molecular formula of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid? |
| A: Molecular formula of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid is C16H24O3. |
| Q: What English synonyms does 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid have? |
| A: English synonyms of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid: [4-(1,1,3,3-tetramethyl-butyl)-phenoxy]-acetic acid, 4-tert-octylphenol monocarboxylate, 2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]acetic acid, [4-(1,1,3,3-Tetramethyl-butyl)-phenoxy]-essigsaeure, 4-tert-octylphenoxy acetic acid, O-[4-(1.1.3.3-Tetramethyl-butyl)-phenyl]-glykolsaeure. |
| Q: What is the polar surface area (PSA) of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid? |
| A: Polar surface area (PSA) of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid is 46.53000. |
| Q: What is the English name of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid? |
| A: The English name of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid is 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid. |
| Q: What is the molecular weight of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid? |
| A: Molecular weight of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid is 264.36000. |
| Q: What is the LogP of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid? |
| A: LogP of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid is 3.86380. |
| Q: What is the InChIKey of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid? |
| A: InChIKey of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid is GPLFPJQMVKFQMK-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid? |
| A: CAS number of 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetic acid is 13402-97-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |