MC-Val-Ala-OH structure
|
Common Name | MC-Val-Ala-OH | ||
|---|---|---|---|---|
| CAS Number | 1342211-31-7 | Molecular Weight | 381.42 | |
| Density | 1.232±0.06 g/cm3(Predicted) | Boiling Point | 695.4±50.0 °C(Predicted) | |
| Molecular Formula | C18H27N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MC-Val-Ala-OHMC-Val-Ala-OH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | MC-Val-Ala-OH |
|---|---|
| Synonym | More Synonyms |
| Description | MC-Val-Ala-OH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Density | 1.232±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 695.4±50.0 °C(Predicted) |
| Molecular Formula | C18H27N3O6 |
| Molecular Weight | 381.42 |
| InChIKey | GSWKJIWKGSPISH-LRDDRELGSA-N |
| SMILES | CC(NC(=O)C(NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C)C(=O)O |
| Hazard Codes | Xn |
|---|
| MFCD27956998 |